C7H7ClF2N2O — CID 123610176
1-[4-(2-chloro-2,2-difluoroethyl)-1H-pyrazol-5-yl]ethanone (PubChem CID 123610176) has the molecular formula C7H7ClF2N2O and a molecular weight of 208.59 g/mol. Its IUPAC name is 1-[4-(2-chloro-2,2-difluoroethyl)-1H-pyrazol-5-yl]ethanone.
| Compound Name | 1-[4-(2-chloro-2,2-difluoroethyl)-1H-pyrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 123610176 |
| Molecular Formula | C7H7ClF2N2O |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 1-[4-(2-chloro-2,2-difluoroethyl)-1H-pyrazol-5-yl]ethanone |
| SMILES | CC(=O)c1[nH]ncc1CC(F)(F)Cl |
| InChI | InChI=1S/C7H7ClF2N2O/c1-4(13)6-5(3-11-12-6)2-7(8,9)10/h3H,2H2,1H3,(H,11,12) |
| InChIKey | HFUDDUSHQBDLCO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|