C6H11N5 — CID 137272488
N-amino-N',4-dimethyl-1H-pyrazole-5-carboximidamide (PubChem CID 137272488) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is N-amino-N',4-dimethyl-1H-pyrazole-5-carboximidamide.
| Compound Name | N-amino-N',4-dimethyl-1H-pyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 137272488 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | N-amino-N',4-dimethyl-1H-pyrazole-5-carboximidamide |
| SMILES | C/N=C(\NN)c1[nH]ncc1C |
| InChI | InChI=1S/C6H11N5/c1-4-3-9-11-5(4)6(8-2)10-7/h3H,7H2,1-2H3,(H,8,10)(H,9,11) |
| InChIKey | VRZCETDYZHWCFT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|