C19H25N5 — CID 161284172
(E)-N-[cyclohepten-1-yl-(5-methyl-1H-pyrazol-4-yl)methyl]-2-(5-ethenyl-1H-pyrazol-4-yl)ethenamine (PubChem CID 161284172) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is (E)-N-[cyclohepten-1-yl-(5-methyl-1H-pyrazol-4-yl)methyl]-2-(5-ethenyl-1H-pyrazol-4-yl)ethenamine.
| Compound Name | (E)-N-[cyclohepten-1-yl-(5-methyl-1H-pyrazol-4-yl)methyl]-2-(5-ethenyl-1H-pyrazol-4-yl)ethenamine |
|---|---|
| PubChem CID | 161284172 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (E)-N-[cyclohepten-1-yl-(5-methyl-1H-pyrazol-4-yl)methyl]-2-(5-ethenyl-1H-pyrazol-4-yl)ethenamine |
| SMILES | C=Cc1[nH]ncc1/C=C/NC(C1=CCCCCC1)c1cn[nH]c1C |
| InChI | InChI=1S/C19H25N5/c1-3-18-16(12-21-24-18)10-11-20-19(17-13-22-23-14(17)2)15-8-6-4-5-7-9-15/h3,8,10-13,19-20H,1,4-7,9H2,2H3,(H,21,24)(H,22,23)/b11-10+ |
| InChIKey | KAFMTFARLLOHKI-ZHACJKMWSA-N |
| XLogP | 4.28 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|