C27H34F3N3O2S — CID 126515026
N-[(3S)-1-hydroxy-5-methylhexan-3-yl]-2-(thiophen-2-ylmethyl)-1-[2-(trifluoromethyl)cyclohexyl]benzimidazole-5-carboxamide (PubChem CID 126515026) has the molecular formula C27H34F3N3O2S and a molecular weight of 521.65 g/mol. Its IUPAC name is N-[(3S)-1-hydroxy-5-methylhexan-3-yl]-2-(thiophen-2-ylmethyl)-1-[2-(trifluoromethyl)cyclohexyl]benzimidazole-5-carboxamide.
| Compound Name | N-[(3S)-1-hydroxy-5-methylhexan-3-yl]-2-(thiophen-2-ylmethyl)-1-[2-(trifluoromethyl)cyclohexyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 126515026 |
| Molecular Formula | C27H34F3N3O2S |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | N-[(3S)-1-hydroxy-5-methylhexan-3-yl]-2-(thiophen-2-ylmethyl)-1-[2-(trifluoromethyl)cyclohexyl]benzimidazole-5-carboxamide |
| SMILES | CC(C)C[C@@H](CCO)NC(=O)c1ccc2c(c1)nc(Cc1cccs1)n2C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C27H34F3N3O2S/c1-17(2)14-19(11-12-34)31-26(35)18-9-10-24-22(15-18)32-25(16-20-6-5-13-36-20)33(24)23-8-4-3-7-21(23)27(28,29)30/h5-6,9-10,13,15,17,19,21,23,34H,3-4,7-8,11-12,14,16H2,1-2H3,(H,31,35)/t19-,21?,23?/m1/s1 |
| InChIKey | ZVYZOGPSXKDBKT-VWRAKTAISA-N |
| XLogP | 6.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |