C27H35N3O4 — CID 90079576
(3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylhexanoic acid (PubChem CID 90079576) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is (3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 90079576 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylhexanoic acid |
| SMILES | CC(C)C[C@@H](CC(=O)O)NC(=O)c1ccc2c(c1)nc(Cc1ccco1)n2C1CCCCC1C |
| InChI | InChI=1S/C27H35N3O4/c1-17(2)13-20(15-26(31)32)28-27(33)19-10-11-24-22(14-19)29-25(16-21-8-6-12-34-21)30(24)23-9-5-4-7-18(23)3/h6,8,10-12,14,17-18,20,23H,4-5,7,9,13,15-16H2,1-3H3,(H,28,33)(H,31,32)/t18?,20-,23?/m0/s1 |
| InChIKey | UHGYBKRERUGRHF-WWAKMMQFSA-N |
| XLogP | 5.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |