C28H37N3O4 — CID 90083756
(3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylheptanoic acid (PubChem CID 90083756) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is (3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylheptanoic acid.
| Compound Name | (3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylheptanoic acid |
|---|---|
| PubChem CID | 90083756 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | (3S)-3-[[2-(furan-2-ylmethyl)-1-(2-methylcyclohexyl)benzimidazole-5-carbonyl]amino]-5-methylheptanoic acid |
| SMILES | CCC(C)C[C@@H](CC(=O)O)NC(=O)c1ccc2c(c1)nc(Cc1ccco1)n2C1CCCCC1C |
| InChI | InChI=1S/C28H37N3O4/c1-4-18(2)14-21(16-27(32)33)29-28(34)20-11-12-25-23(15-20)30-26(17-22-9-7-13-35-22)31(25)24-10-6-5-8-19(24)3/h7,9,11-13,15,18-19,21,24H,4-6,8,10,14,16-17H2,1-3H3,(H,29,34)(H,32,33)/t18?,19?,21-,24?/m0/s1 |
| InChIKey | BLHQRFQFGGPWBN-WCCMRHTKSA-N |
| XLogP | 5.98 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |