C28H37N3O3S — CID 90087663
(4R)-6-methyl-4-[[1-[(2R)-2-methylcyclohexyl]-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]heptanoic acid (PubChem CID 90087663) has the molecular formula C28H37N3O3S and a molecular weight of 495.69 g/mol. Its IUPAC name is (4R)-6-methyl-4-[[1-[(2R)-2-methylcyclohexyl]-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]heptanoic acid.
| Compound Name | (4R)-6-methyl-4-[[1-[(2R)-2-methylcyclohexyl]-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 90087663 |
| Molecular Formula | C28H37N3O3S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (4R)-6-methyl-4-[[1-[(2R)-2-methylcyclohexyl]-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]heptanoic acid |
| SMILES | CC(C)C[C@@H](CCC(=O)O)NC(=O)c1ccc2c(c1)nc(Cc1cccs1)n2C1CCCC[C@H]1C |
| InChI | InChI=1S/C28H37N3O3S/c1-18(2)15-21(11-13-27(32)33)29-28(34)20-10-12-25-23(16-20)30-26(17-22-8-6-14-35-22)31(25)24-9-5-4-7-19(24)3/h6,8,10,12,14,16,18-19,21,24H,4-5,7,9,11,13,15,17H2,1-3H3,(H,29,34)(H,32,33)/t19-,21-,24?/m1/s1 |
| InChIKey | PVPGDYHYHXNPIR-MRBOTJLVSA-N |
| XLogP | 6.45 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |