C14H9N3S — CID 126516642
17-thia-3,15,18-triazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),3,5,8,11(16),12,14-octaene (PubChem CID 126516642) has the molecular formula C14H9N3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 17-thia-3,15,18-triazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),3,5,8,11(16),12,14-octaene.
| Compound Name | 17-thia-3,15,18-triazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 126516642 |
| Molecular Formula | C14H9N3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 17-thia-3,15,18-triazatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
| SMILES | c1cnc2c(c1)-c1ccc3cccnc3c1NS2 |
| InChI | InChI=1S/C14H9N3S/c1-3-9-5-6-10-11-4-2-8-16-14(11)18-17-13(10)12(9)15-7-1/h1-8,17H |
| InChIKey | JBUNBVFERWDMLF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|