C19H18P2 — CID 126518534
[4-[2-methyl-5-(4-phosphanylphenyl)phenyl]phenyl]phosphane (PubChem CID 126518534) has the molecular formula C19H18P2 and a molecular weight of 308.30 g/mol. Its IUPAC name is [4-[2-methyl-5-(4-phosphanylphenyl)phenyl]phenyl]phosphane.
| Compound Name | [4-[2-methyl-5-(4-phosphanylphenyl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 126518534 |
| Molecular Formula | C19H18P2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [4-[2-methyl-5-(4-phosphanylphenyl)phenyl]phenyl]phosphane |
| SMILES | Cc1ccc(-c2ccc(P)cc2)cc1-c1ccc(P)cc1 |
| InChI | InChI=1S/C19H18P2/c1-13-2-3-16(14-4-8-17(20)9-5-14)12-19(13)15-6-10-18(21)11-7-15/h2-12H,20-21H2,1H3 |
| InChIKey | KZZCPPMDVQLXRI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|