C22H23P — CID 160800669
[2-methyl-4-[4-(2,4,5-trimethylphenyl)phenyl]phenyl]phosphane (PubChem CID 160800669) has the molecular formula C22H23P and a molecular weight of 318.40 g/mol. Its IUPAC name is [2-methyl-4-[4-(2,4,5-trimethylphenyl)phenyl]phenyl]phosphane.
| Compound Name | [2-methyl-4-[4-(2,4,5-trimethylphenyl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 160800669 |
| Molecular Formula | C22H23P |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [2-methyl-4-[4-(2,4,5-trimethylphenyl)phenyl]phenyl]phosphane |
| SMILES | Cc1cc(C)c(-c2ccc(-c3ccc(P)c(C)c3)cc2)cc1C |
| InChI | InChI=1S/C22H23P/c1-14-11-16(3)21(13-15(14)2)19-7-5-18(6-8-19)20-9-10-22(23)17(4)12-20/h5-13H,23H2,1-4H3 |
| InChIKey | OTVISJPVFOMYMS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|