C21H23P3 — CID 129088140
[4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-2-methylphenyl]phosphane (PubChem CID 129088140) has the molecular formula C21H23P3 and a molecular weight of 368.34 g/mol. Its IUPAC name is [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-2-methylphenyl]phosphane.
| Compound Name | [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-2-methylphenyl]phosphane |
|---|---|
| PubChem CID | 129088140 |
| Molecular Formula | C21H23P3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-2-methylphenyl]phosphane |
| SMILES | Cc1cc(-c2cccc(-c3cc(CP)cc(CP)c3)c2)ccc1P |
| InChI | InChI=1S/C21H23P3/c1-14-7-19(5-6-21(14)24)17-3-2-4-18(11-17)20-9-15(12-22)8-16(10-20)13-23/h2-11H,12-13,22-24H2,1H3 |
| InChIKey | BIDJXGXMMFTXNZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|