C17H15Cl2NO3 — CID 126530816
(3S,4R,5S)-5-(3,6-dichlorocarbazol-9-yl)oxane-3,4-diol (PubChem CID 126530816) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is (3S,4R,5S)-5-(3,6-dichlorocarbazol-9-yl)oxane-3,4-diol.
| Compound Name | (3S,4R,5S)-5-(3,6-dichlorocarbazol-9-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 126530816 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (3S,4R,5S)-5-(3,6-dichlorocarbazol-9-yl)oxane-3,4-diol |
| SMILES | O[C@H]1[C@@H](O)COC[C@@H]1n1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H15Cl2NO3/c18-9-1-3-13-11(5-9)12-6-10(19)2-4-14(12)20(13)15-7-23-8-16(21)17(15)22/h1-6,15-17,21-22H,7-8H2/t15-,16-,17+/m0/s1 |
| InChIKey | ITQNRYNXJUJADF-YESZJQIVSA-N |
| XLogP | 3.39 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |