C18H20Cl2N2O — CID 2855364
1-(3,6-dichlorocarbazol-9-yl)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 2855364) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is 1-(3,6-dichlorocarbazol-9-yl)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-(3,6-dichlorocarbazol-9-yl)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 2855364 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-(3,6-dichlorocarbazol-9-yl)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(O)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-11(2)21-9-14(23)10-22-17-5-3-12(19)7-15(17)16-8-13(20)4-6-18(16)22/h3-8,11,14,21,23H,9-10H2,1-2H3 |
| InChIKey | KOZMMZGWHLFBOI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |