About 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole
5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole (PubChem CID 126536455) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole.
Molecular Properties
| Compound Name | 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole |
| PubChem CID | 126536455 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole |
| SMILES | Cc1cccc(C2=NNNN2)c1 |
| InChI | InChI=1S/C8H10N4/c1-6-3-2-4-7(5-6)8-9-11-12-10-8/h2-5,11-12H,1H3,(H,9,10) |
| InChIKey | VLDBHWQJHGQUGL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole?
The IUPAC name of 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole (CID 126536455) is 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole.
What is the SMILES notation for 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole?
The canonical SMILES for 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole is Cc1cccc(C2=NNNN2)c1.
What is the InChIKey of 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole?
The InChIKey is VLDBHWQJHGQUGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-6-3-2-4-7(5-6)8-9-11-12-10-8/h2-5,11-12H,1H3,(H,9,10).
What are the key properties of 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole?
5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole has a molecular weight of 162.20 g/mol, XLogP of 0.27, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole is sourced from PubChem (CID 126536455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).