C8H10N4 — CID 126536455
5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole (PubChem CID 126536455) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole.
| Compound Name | 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole |
|---|---|
| PubChem CID | 126536455 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-(3-methylphenyl)-2,3-dihydro-1H-tetrazole |
| SMILES | Cc1cccc(C2=NNNN2)c1 |
| InChI | InChI=1S/C8H10N4/c1-6-3-2-4-7(5-6)8-9-11-12-10-8/h2-5,11-12H,1H3,(H,9,10) |
| InChIKey | VLDBHWQJHGQUGL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |