C12H16N2O2 — CID 45093599
(4R,5S)-4,5-dimethyl-2-(3-methylphenyl)-1H-imidazole-4,5-diol (PubChem CID 45093599) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethyl-2-(3-methylphenyl)-1H-imidazole-4,5-diol.
| Compound Name | (4R,5S)-4,5-dimethyl-2-(3-methylphenyl)-1H-imidazole-4,5-diol |
|---|---|
| PubChem CID | 45093599 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (4R,5S)-4,5-dimethyl-2-(3-methylphenyl)-1H-imidazole-4,5-diol |
| SMILES | Cc1cccc(C2=N[C@](C)(O)[C@](C)(O)N2)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-8-5-4-6-9(7-8)10-13-11(2,15)12(3,16)14-10/h4-7,15-16H,1-3H3,(H,13,14)/t11-,12+ |
| InChIKey | WWVQYEFTRYFNAJ-TXEJJXNPSA-N |
| XLogP | 0.76 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |