C28H39FN4O2 — CID 126538885
N-[[4-(4-benzylpiperazin-1-yl)-2,2-dimethyloxan-4-yl]methyl]-N-(3-ethyloxiran-2-yl)-3-fluoropyridin-2-amine (PubChem CID 126538885) has the molecular formula C28H39FN4O2 and a molecular weight of 482.64 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)-2,2-dimethyloxan-4-yl]methyl]-N-(3-ethyloxiran-2-yl)-3-fluoropyridin-2-amine.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)-2,2-dimethyloxan-4-yl]methyl]-N-(3-ethyloxiran-2-yl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 126538885 |
| Molecular Formula | C28H39FN4O2 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)-2,2-dimethyloxan-4-yl]methyl]-N-(3-ethyloxiran-2-yl)-3-fluoropyridin-2-amine |
| SMILES | CCC1OC1N(CC1(N2CCN(Cc3ccccc3)CC2)CCOC(C)(C)C1)c1ncccc1F |
| InChI | InChI=1S/C28H39FN4O2/c1-4-24-26(35-24)33(25-23(29)11-8-13-30-25)21-28(12-18-34-27(2,3)20-28)32-16-14-31(15-17-32)19-22-9-6-5-7-10-22/h5-11,13,24,26H,4,12,14-21H2,1-3H3 |
| InChIKey | DHDATQYXQZDRIW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|