C23H40N2O7 — CID 126539445
[(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate (PubChem CID 126539445) has the molecular formula C23H40N2O7 and a molecular weight of 456.60 g/mol. Its IUPAC name is [(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate.
| Compound Name | [(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 126539445 |
| Molecular Formula | C23H40N2O7 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | [(3R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate |
| SMILES | CC(=CC[C@@H]1[C@@](O1)(C)C2C(C(CC[C@]23CO3)OC(=O)NCCOCCOCCN)OC)C |
| InChI | InChI=1S/C23H40N2O7/c1-16(2)5-6-18-22(3,32-18)20-19(27-4)17(7-8-23(20)15-30-23)31-21(26)25-10-12-29-14-13-28-11-9-24/h5,17-20H,6-15,24H2,1-4H3,(H,25,26)/t17?,18-,19?,20?,22+,23+/m1/s1 |
| InChIKey | BASBOUHIBIVRDK-LPZLWCLFSA-N |
| XLogP | 0.90 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | 656 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|