C21H35N3O6 — CID 20872960
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-aminoethylamino)acetyl]carbamate (PubChem CID 20872960) has the molecular formula C21H35N3O6 and a molecular weight of 425.53 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-aminoethylamino)acetyl]carbamate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-aminoethylamino)acetyl]carbamate |
|---|---|
| PubChem CID | 20872960 |
| Molecular Formula | C21H35N3O6 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-aminoethylamino)acetyl]carbamate |
| SMILES | COC1C(OC(=O)NC(=O)CNCCN)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C21H35N3O6/c1-13(2)5-6-15-20(3,30-15)18-17(27-4)14(7-8-21(18)12-28-21)29-19(26)24-16(25)11-23-10-9-22/h5,14-15,17-18,23H,6-12,22H2,1-4H3,(H,24,25,26) |
| InChIKey | VDJNBKGHVGYSHU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|