C29H50N4O7 — CID 148967407
[(3R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[3-[6-[[2-(methylamino)acetyl]amino]hexylamino]-3-oxopropyl]carbamate (PubChem CID 148967407) has the molecular formula C29H50N4O7 and a molecular weight of 566.74 g/mol. Its IUPAC name is [(3R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[3-[6-[[2-(methylamino)acetyl]amino]hexylamino]-3-oxopropyl]carbamate.
| Compound Name | [(3R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[3-[6-[[2-(methylamino)acetyl]amino]hexylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 148967407 |
| Molecular Formula | C29H50N4O7 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | [(3R)-5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[3-[6-[[2-(methylamino)acetyl]amino]hexylamino]-3-oxopropyl]carbamate |
| SMILES | CNCC(=O)NCCCCCCNC(=O)CCNC(=O)OC1CC[C@]2(CO2)C(C2(C)O[C@@H]2CC=C(C)C)C1OC |
| InChI | InChI=1S/C29H50N4O7/c1-20(2)10-11-22-28(3,40-22)26-25(37-5)21(12-14-29(26)19-38-29)39-27(36)33-17-13-23(34)31-15-8-6-7-9-16-32-24(35)18-30-4/h10,21-22,25-26,30H,6-9,11-19H2,1-5H3,(H,31,34)(H,32,35)(H,33,36)/t21?,22-,25?,26?,28?,29+/m1/s1 |
| InChIKey | PTERXIGZUQEPJA-LJKLMCTESA-N |
| XLogP | 2.19 |
| TPSA | 142.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|