C30H51N3O8 — CID 174066250
[(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(butoxycarbonylamino)ethyl-butylamino]acetyl]carbamate (PubChem CID 174066250) has the molecular formula C30H51N3O8 and a molecular weight of 581.75 g/mol. Its IUPAC name is [(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(butoxycarbonylamino)ethyl-butylamino]acetyl]carbamate.
| Compound Name | [(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(butoxycarbonylamino)ethyl-butylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 174066250 |
| Molecular Formula | C30H51N3O8 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.37 |
| IUPAC Name | [(3R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-[2-(butoxycarbonylamino)ethyl-butylamino]acetyl]carbamate |
| SMILES | CCCCOC(=O)NCCN(CCCC)CC(=O)NC(=O)OC1CC[C@]2(CO2)C(C2(C)O[C@@H]2CC=C(C)C)C1OC |
| InChI | InChI=1S/C30H51N3O8/c1-7-9-16-33(17-15-31-27(35)38-18-10-8-2)19-24(34)32-28(36)40-22-13-14-30(20-39-30)26(25(22)37-6)29(5)23(41-29)12-11-21(3)4/h11,22-23,25-26H,7-10,12-20H2,1-6H3,(H,31,35)(H,32,34,36)/t22?,23-,25?,26?,29?,30+/m1/s1 |
| InChIKey | LFFSTKOYEZCMRN-FYGCDERZSA-N |
| XLogP | 3.94 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|