C22H35NO — CID 126539512
1-[4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl]propan-1-amine (PubChem CID 126539512) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is 1-[4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl]propan-1-amine.
| Compound Name | 1-[4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl]propan-1-amine |
|---|---|
| PubChem CID | 126539512 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 1-[4-[4-(4-methoxyphenyl)cyclohexyl]cyclohexyl]propan-1-amine |
| SMILES | CCC(N)C1CCC(C2CCC(c3ccc(OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H35NO/c1-3-22(23)20-10-8-18(9-11-20)16-4-6-17(7-5-16)19-12-14-21(24-2)15-13-19/h12-18,20,22H,3-11,23H2,1-2H3 |
| InChIKey | NYPONWOLEOYOGA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |