C25H41NO2 — CID 143707745
1-[4-[4-[4-(3-methoxypropoxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine (PubChem CID 143707745) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 1-[4-[4-[4-(3-methoxypropoxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine.
| Compound Name | 1-[4-[4-[4-(3-methoxypropoxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine |
|---|---|
| PubChem CID | 143707745 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 1-[4-[4-[4-(3-methoxypropoxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine |
| SMILES | CCC(N)C1CCC(C2CCC(c3ccc(OCCCOC)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H41NO2/c1-3-25(26)23-11-9-21(10-12-23)19-5-7-20(8-6-19)22-13-15-24(16-14-22)28-18-4-17-27-2/h13-16,19-21,23,25H,3-12,17-18,26H2,1-2H3 |
| InChIKey | BKSHSNQWCBOGHI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|