C27H45NO2 — CID 154558214
1-[4-[4-[4-(4-methoxypentan-2-yloxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine (PubChem CID 154558214) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-methoxypentan-2-yloxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine.
| Compound Name | 1-[4-[4-[4-(4-methoxypentan-2-yloxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine |
|---|---|
| PubChem CID | 154558214 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | 1-[4-[4-[4-(4-methoxypentan-2-yloxy)phenyl]cyclohexyl]cyclohexyl]propan-1-amine |
| SMILES | CCC(N)C1CCC(C2CCC(c3ccc(OC(C)CC(C)OC)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H45NO2/c1-5-27(28)25-12-10-23(11-13-25)21-6-8-22(9-7-21)24-14-16-26(17-15-24)30-20(3)18-19(2)29-4/h14-17,19-23,25,27H,5-13,18,28H2,1-4H3 |
| InChIKey | LIUYQHLLYVUNDG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |