C26H42O2 — CID 70860397
4-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pentan-2-ol (PubChem CID 70860397) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 4-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pentan-2-ol.
| Compound Name | 4-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pentan-2-ol |
|---|---|
| PubChem CID | 70860397 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 4-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenoxy]pentan-2-ol |
| SMILES | CCCC1CCC(C2CCC(c3ccc(OC(C)CC(C)O)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H42O2/c1-4-5-21-6-8-22(9-7-21)23-10-12-24(13-11-23)25-14-16-26(17-15-25)28-20(3)18-19(2)27/h14-17,19-24,27H,4-13,18H2,1-3H3 |
| InChIKey | ALYDUOFCNAQDFM-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |