C25H34F2O2 — CID 101167002
[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl] 2,2-difluorocyclopropane-1-carboxylate (PubChem CID 101167002) has the molecular formula C25H34F2O2 and a molecular weight of 404.54 g/mol. Its IUPAC name is [4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl] 2,2-difluorocyclopropane-1-carboxylate.
| Compound Name | [4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl] 2,2-difluorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101167002 |
| Molecular Formula | C25H34F2O2 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | [4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl] 2,2-difluorocyclopropane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(c3ccc(OC(=O)C4CC4(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H34F2O2/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-14-22(15-13-21)29-24(28)23-16-25(23,26)27/h12-15,17-20,23H,2-11,16H2,1H3 |
| InChIKey | FWDVOHRJFYKDQU-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|