C41H30N4 — CID 126543598
2-(9,9-dimethylfluoren-4-yl)-4,6-bis(4-pyridin-3-ylphenyl)pyrimidine (PubChem CID 126543598) has the molecular formula C41H30N4 and a molecular weight of 578.72 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-4-yl)-4,6-bis(4-pyridin-3-ylphenyl)pyrimidine.
| Compound Name | 2-(9,9-dimethylfluoren-4-yl)-4,6-bis(4-pyridin-3-ylphenyl)pyrimidine |
|---|---|
| PubChem CID | 126543598 |
| Molecular Formula | C41H30N4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 2-(9,9-dimethylfluoren-4-yl)-4,6-bis(4-pyridin-3-ylphenyl)pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2c(-c3nc(-c4ccc(-c5cccnc5)cc4)cc(-c4ccc(-c5cccnc5)cc4)n3)cccc21 |
| InChI | InChI=1S/C41H30N4/c1-41(2)35-12-4-3-10-33(35)39-34(11-5-13-36(39)41)40-44-37(29-18-14-27(15-19-29)31-8-6-22-42-25-31)24-38(45-40)30-20-16-28(17-21-30)32-9-7-23-43-26-32/h3-26H,1-2H3 |
| InChIKey | FVYHNMGJGKIRGC-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |