C19H26ClN — CID 126544065
8-chloro-2-(2,2,3,4,4-pentamethylpentan-3-yl)quinoline (PubChem CID 126544065) has the molecular formula C19H26ClN and a molecular weight of 303.88 g/mol. Its IUPAC name is 8-chloro-2-(2,2,3,4,4-pentamethylpentan-3-yl)quinoline.
| Compound Name | 8-chloro-2-(2,2,3,4,4-pentamethylpentan-3-yl)quinoline |
|---|---|
| PubChem CID | 126544065 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 8-chloro-2-(2,2,3,4,4-pentamethylpentan-3-yl)quinoline |
| SMILES | CC(C)(C)C(C)(c1ccc2cccc(Cl)c2n1)C(C)(C)C |
| InChI | InChI=1S/C19H26ClN/c1-17(2,3)19(7,18(4,5)6)15-12-11-13-9-8-10-14(20)16(13)21-15/h8-12H,1-7H3 |
| InChIKey | NJJHWMFRKZWWHA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |