C19H26IN — CID 126544224
2-[(3S)-2-iodo-2,3,4,4-tetramethylpentan-3-yl]-8-methylquinoline (PubChem CID 126544224) has the molecular formula C19H26IN and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-[(3S)-2-iodo-2,3,4,4-tetramethylpentan-3-yl]-8-methylquinoline.
| Compound Name | 2-[(3S)-2-iodo-2,3,4,4-tetramethylpentan-3-yl]-8-methylquinoline |
|---|---|
| PubChem CID | 126544224 |
| Molecular Formula | C19H26IN |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[(3S)-2-iodo-2,3,4,4-tetramethylpentan-3-yl]-8-methylquinoline |
| SMILES | Cc1cccc2ccc([C@](C)(C(C)(C)C)C(C)(C)I)nc12 |
| InChI | InChI=1S/C19H26IN/c1-13-9-8-10-14-11-12-15(21-16(13)14)19(7,17(2,3)4)18(5,6)20/h8-12H,1-7H3/t19-/m1/s1 |
| InChIKey | YRZHXFNFUFCBAT-LJQANCHMSA-N |
| XLogP | 6.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|