C34H40Cl2N8O4 — CID 126545950
tert-butyl (7R,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate (PubChem CID 126545950) has the molecular formula C34H40Cl2N8O4 and a molecular weight of 695.65 g/mol. Its IUPAC name is tert-butyl (7R,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate.
| Compound Name | tert-butyl (7R,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate |
|---|---|
| PubChem CID | 126545950 |
| Molecular Formula | C34H40Cl2N8O4 |
| Molecular Weight | 695.65 g/mol |
| Exact Mass | 694.25 |
| IUPAC Name | tert-butyl (7R,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cccc(c3)[C@@H](n3cnc(-c4cc(Cl)ccc4N4C=C(Cl)NN4)cc3=O)CCCCCNC(=O)[C@H]2C1 |
| InChI | InChI=1S/C34H40Cl2N8O4/c1-34(2,3)48-33(47)41-14-15-42-24-9-7-8-22(16-24)27(10-5-4-6-13-37-32(46)29(42)19-41)43-21-38-26(18-31(43)45)25-17-23(35)11-12-28(25)44-20-30(36)39-40-44/h7-9,11-12,16-18,20-21,27,29,39-40H,4-6,10,13-15,19H2,1-3H3,(H,37,46)/t27-,29+/m0/s1 |
| InChIKey | SSYZTKSCXYYGMS-LMSSTIIKSA-N |
| XLogP | 5.14 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|