C34H38Cl2N8O5 — CID 126545645
tert-butyl (7S,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-3,8-dioxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate (PubChem CID 126545645) has the molecular formula C34H38Cl2N8O5 and a molecular weight of 709.64 g/mol. Its IUPAC name is tert-butyl (7S,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-3,8-dioxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate.
| Compound Name | tert-butyl (7S,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-3,8-dioxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate |
|---|---|
| PubChem CID | 126545645 |
| Molecular Formula | C34H38Cl2N8O5 |
| Molecular Weight | 709.64 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | tert-butyl (7S,15S)-15-[4-[5-chloro-2-(5-chloro-1,2-dihydrotriazol-3-yl)phenyl]-6-oxopyrimidin-1-yl]-3,8-dioxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)N2c3cccc(c3)[C@@H](n3cnc(-c4cc(Cl)ccc4N4C=C(Cl)NN4)cc3=O)CCCCCNC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H38Cl2N8O5/c1-34(2,3)49-33(48)41-17-28-32(47)37-13-6-4-5-10-26(21-8-7-9-23(14-21)44(28)31(46)19-41)42-20-38-25(16-30(42)45)24-15-22(35)11-12-27(24)43-18-29(36)39-40-43/h7-9,11-12,14-16,18,20,26,28,39-40H,4-6,10,13,17,19H2,1-3H3,(H,37,47)/t26-,28-/m0/s1 |
| InChIKey | WJVDGJTWVJIJJK-XCZPVHLTSA-N |
| XLogP | 4.66 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|