C22H34N4O3 — CID 146651982
tert-butyl (7R)-15-amino-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate (PubChem CID 146651982) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl (7R)-15-amino-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate.
| Compound Name | tert-butyl (7R)-15-amino-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate |
|---|---|
| PubChem CID | 146651982 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl (7R)-15-amino-8-oxo-2,5,9-triazatricyclo[14.3.1.02,7]icosa-1(19),16(20),17-triene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2c3cccc(c3)C(N)CCCCCNC(=O)[C@H]2C1 |
| InChI | InChI=1S/C22H34N4O3/c1-22(2,3)29-21(28)25-12-13-26-17-9-7-8-16(14-17)18(23)10-5-4-6-11-24-20(27)19(26)15-25/h7-9,14,18-19H,4-6,10-13,15,23H2,1-3H3,(H,24,27)/t18?,19-/m1/s1 |
| InChIKey | HTECHWZLPCVCRL-MUMRKEEXSA-N |
| XLogP | 2.80 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |