About Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate
Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate (PubChem CID 171844058) has the molecular formula C24H34N4O4
and a molecular weight of 442.60 g/mol. Its IUPAC name is tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate |
| PubChem CID | 171844058 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC3=C(C=C2)N(C(=O)N3C)C4CCCCNC4=O |
| InChI | InChI=1S/C24H34N4O4/c1-24(2,3)32-23(31)27-13-10-16(11-14-27)17-8-9-18-20(15-17)26(4)22(30)28(18)19-7-5-6-12-25-21(19)29/h8-9,15-16,19H,5-7,10-14H2,1-4H3,(H,25,29) |
| InChIKey | LUVAILHONWIWMO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | 728 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate?
The IUPAC name of Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate (CID 171844058) is tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate.
What is the SMILES notation for Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate?
The canonical SMILES for Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(CC1)C2=CC3=C(C=C2)N(C(=O)N3C)C4CCCCNC4=O.
What is the InChIKey of Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate?
The InChIKey is LUVAILHONWIWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N4O4/c1-24(2,3)32-23(31)27-13-10-16(11-14-27)17-8-9-18-20(15-17)26(4)22(30)28(18)19-7-5-6-12-25-21(19)29/h8-9,15-16,19H,5-7,10-14H2,1-4H3,(H,25,29).
What are the key properties of Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate?
Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate has a molecular weight of 442.60 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 4-[3-methyl-2-oxo-1-(2-oxoazepan-3-yl)benzimidazol-5-yl]piperidine-1-carboxylate is sourced from PubChem (CID 171844058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).