C18H32N2O3S — CID 167986408
tert-butyl 4-[(2-oxoazepan-3-yl)methylsulfanylmethyl]piperidine-1-carboxylate (PubChem CID 167986408) has the molecular formula C18H32N2O3S and a molecular weight of 356.53 g/mol. Its IUPAC name is tert-butyl 4-[(2-oxoazepan-3-yl)methylsulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-oxoazepan-3-yl)methylsulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167986408 |
| Molecular Formula | C18H32N2O3S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | tert-butyl 4-[(2-oxoazepan-3-yl)methylsulfanylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CSCC2CCCCNC2=O)CC1 |
| InChI | InChI=1S/C18H32N2O3S/c1-18(2,3)23-17(22)20-10-7-14(8-11-20)12-24-13-15-6-4-5-9-19-16(15)21/h14-15H,4-13H2,1-3H3,(H,19,21) |
| InChIKey | ARPSSTVVNOBLGU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |