C26H29F3N6O2 — CID 126549539
(1S,2R,3S,4S)-3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-6-phenylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 126549539) has the molecular formula C26H29F3N6O2 and a molecular weight of 514.55 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-6-phenylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2R,3S,4S)-3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-6-phenylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 126549539 |
| Molecular Formula | C26H29F3N6O2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | (1S,2R,3S,4S)-3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-6-phenylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CC(=O)N1CCC[C@H](Nc2ncc(C(F)(F)F)c(N[C@@H]3[C@H](C(N)=O)[C@@H]4C[C@H]3C=C4c3ccccc3)n2)C1 |
| InChI | InChI=1S/C26H29F3N6O2/c1-14(36)35-9-5-8-17(13-35)32-25-31-12-20(26(27,28)29)24(34-25)33-22-16-10-18(15-6-3-2-4-7-15)19(11-16)21(22)23(30)37/h2-4,6-7,10,12,16-17,19,21-22H,5,8-9,11,13H2,1H3,(H2,30,37)(H2,31,32,33,34)/t16-,17+,19-,21-,22+/m1/s1 |
| InChIKey | VPZCCERTONCBQC-VVMYPULBSA-N |
| XLogP | 3.53 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |