C24H28F3N7O2 — CID 123647137
3-[[4-[4-cyclobutyl-2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxamide (PubChem CID 123647137) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 3-[[4-[4-cyclobutyl-2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxamide.
| Compound Name | 3-[[4-[4-cyclobutyl-2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 123647137 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 3-[[4-[4-cyclobutyl-2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]piperidine-1-carboxamide |
| SMILES | C=CC(=O)Nc1cc(C2CCC2)ccc1Nc1nc(NC2CCCN(C(N)=O)C2)ncc1C(F)(F)F |
| InChI | InChI=1S/C24H28F3N7O2/c1-2-20(35)31-19-11-15(14-5-3-6-14)8-9-18(19)32-21-17(24(25,26)27)12-29-23(33-21)30-16-7-4-10-34(13-16)22(28)36/h2,8-9,11-12,14,16H,1,3-7,10,13H2,(H2,28,36)(H,31,35)(H2,29,30,32,33) |
| InChIKey | YCLOZDDWZIWAGZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|