C20H24N2O5 — CID 126549685
(1R,8R,9R,10S,13S)-4,8,10-trihydroxy-17-methylspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione (PubChem CID 126549685) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is (1R,8R,9R,10S,13S)-4,8,10-trihydroxy-17-methylspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione.
| Compound Name | (1R,8R,9R,10S,13S)-4,8,10-trihydroxy-17-methylspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione |
|---|---|
| PubChem CID | 126549685 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (1R,8R,9R,10S,13S)-4,8,10-trihydroxy-17-methylspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione |
| SMILES | CN1CC[C@]23C[C@]4(CC[C@@]2(O)[C@H]1[C@H](O)c1ccc(O)cc13)NC(=O)CC4=O |
| InChI | InChI=1S/C20H24N2O5/c1-22-7-6-18-10-19(14(24)9-15(25)21-19)4-5-20(18,27)17(22)16(26)12-3-2-11(23)8-13(12)18/h2-3,8,16-17,23,26-27H,4-7,9-10H2,1H3,(H,21,25)/t16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | KIZMKFKEKSAVFN-LTFPLMDUSA-N |
| XLogP | 0.12 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|