C24H29FN2O4 — CID 126549678
(1R,8R,9S,10S,13S)-17-(cyclopropylmethyl)-8-fluoro-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione (PubChem CID 126549678) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is (1R,8R,9S,10S,13S)-17-(cyclopropylmethyl)-8-fluoro-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione.
| Compound Name | (1R,8R,9S,10S,13S)-17-(cyclopropylmethyl)-8-fluoro-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione |
|---|---|
| PubChem CID | 126549678 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (1R,8R,9S,10S,13S)-17-(cyclopropylmethyl)-8-fluoro-10-hydroxy-4-methoxyspiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,5'-pyrrolidine]-2',4'-dione |
| SMILES | COc1ccc2c(c1)[C@]13CCN(CC4CC4)[C@H]([C@@H]2F)[C@]1(O)CC[C@@]1(C3)NC(=O)CC1=O |
| InChI | InChI=1S/C24H29FN2O4/c1-31-15-4-5-16-17(10-15)22-8-9-27(12-14-2-3-14)21(20(16)25)24(22,30)7-6-23(13-22)18(28)11-19(29)26-23/h4-5,10,14,20-21,30H,2-3,6-9,11-13H2,1H3,(H,26,29)/t20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | VLPXWZBZLOXSDH-ZSXJVMONSA-N |
| XLogP | 2.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|