C23H31N3O5 — CID 134590729
(1S,10R,11S,12S)-21-(cyclopropylmethyl)-10,12-dihydroxy-16-methoxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione (PubChem CID 134590729) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is (1S,10R,11S,12S)-21-(cyclopropylmethyl)-10,12-dihydroxy-16-methoxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione.
| Compound Name | (1S,10R,11S,12S)-21-(cyclopropylmethyl)-10,12-dihydroxy-16-methoxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione |
|---|---|
| PubChem CID | 134590729 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (1S,10R,11S,12S)-21-(cyclopropylmethyl)-10,12-dihydroxy-16-methoxy-4,6,21-triazatetracyclo[9.7.3.01,10.013,18]henicosa-13(18),14,16-triene-3,5-dione |
| SMILES | COc1ccc2c(c1)[C@@]13CCN(CC4CC4)[C@@H]([C@H]2O)[C@@]1(O)CCCNC(=O)NC(=O)C3 |
| InChI | InChI=1S/C23H31N3O5/c1-31-15-5-6-16-17(11-15)22-8-10-26(13-14-3-4-14)20(19(16)28)23(22,30)7-2-9-24-21(29)25-18(27)12-22/h5-6,11,14,19-20,28,30H,2-4,7-10,12-13H2,1H3,(H2,24,25,27,29)/t19-,20-,22-,23-/m0/s1 |
| InChIKey | MTJRMKUZHVMNRR-SQOUVECCSA-N |
| XLogP | 1.21 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |