C22H28F2O — CID 126551718
1-(difluoromethoxy)-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene (PubChem CID 126551718) has the molecular formula C22H28F2O and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene.
| Compound Name | 1-(difluoromethoxy)-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 126551718 |
| Molecular Formula | C22H28F2O |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-(difluoromethoxy)-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]benzene |
| SMILES | C/C=C/C1CCC(C2CC=C(c3ccc(OC(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H28F2O/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(15-13-20)25-22(23)24/h2-3,10,12-18,22H,4-9,11H2,1H3/b3-2+ |
| InChIKey | LDTNQTBINPLRHH-NSCUHMNNSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|