C7H7N3O2S — CID 126553491
(4,6-dimethoxypyrimidin-5-yl) thiocyanate (PubChem CID 126553491) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is (4,6-dimethoxypyrimidin-5-yl) thiocyanate.
| Compound Name | (4,6-dimethoxypyrimidin-5-yl) thiocyanate |
|---|---|
| PubChem CID | 126553491 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | (4,6-dimethoxypyrimidin-5-yl) thiocyanate |
| SMILES | COc1ncnc(OC)c1SC#N |
| InChI | InChI=1S/C7H7N3O2S/c1-11-6-5(13-3-8)7(12-2)10-4-9-6/h4H,1-2H3 |
| InChIKey | KWVKAMCHGVCDBG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|