C20H23N5S — CID 126555572
4-(4-aminophenyl)-N-[(E)-1,2-dihydroindol-3-ylidenemethyl]piperazine-1-carbothioamide (PubChem CID 126555572) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[(E)-1,2-dihydroindol-3-ylidenemethyl]piperazine-1-carbothioamide.
| Compound Name | 4-(4-aminophenyl)-N-[(E)-1,2-dihydroindol-3-ylidenemethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555572 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-(4-aminophenyl)-N-[(E)-1,2-dihydroindol-3-ylidenemethyl]piperazine-1-carbothioamide |
| SMILES | Nc1ccc(N2CCN(C(=S)N/C=C3/CNc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C20H23N5S/c21-16-5-7-17(8-6-16)24-9-11-25(12-10-24)20(26)23-14-15-13-22-19-4-2-1-3-18(15)19/h1-8,14,22H,9-13,21H2,(H,23,26)/b15-14- |
| InChIKey | XUJXUJIFQIBSFY-PFONDFGASA-N |
| XLogP | 2.73 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|