C20H23N5OS — CID 126556003
N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-pyrazin-2-ylpiperazine-1-carbothioamide (PubChem CID 126556003) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-pyrazin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-pyrazin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126556003 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-pyrazin-2-ylpiperazine-1-carbothioamide |
| SMILES | S=C(N/C=C1/CCCOc2ccccc21)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C20H23N5OS/c27-20(25-11-9-24(10-12-25)19-15-21-7-8-22-19)23-14-16-4-3-13-26-18-6-2-1-5-17(16)18/h1-2,5-8,14-15H,3-4,9-13H2,(H,23,27)/b16-14- |
| InChIKey | CTMWGMJAIGLNCA-PEZBUJJGSA-N |
| XLogP | 2.69 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|