C18H23N7OS — CID 126557887
N-[(Z)-(8-methyl-2,3,8,8a-tetrahydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-pyrazin-2-ylpiperazine-1-carbothioamide (PubChem CID 126557887) has the molecular formula C18H23N7OS and a molecular weight of 385.50 g/mol. Its IUPAC name is N-[(Z)-(8-methyl-2,3,8,8a-tetrahydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-pyrazin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(8-methyl-2,3,8,8a-tetrahydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-pyrazin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126557887 |
| Molecular Formula | C18H23N7OS |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-[(Z)-(8-methyl-2,3,8,8a-tetrahydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-pyrazin-2-ylpiperazine-1-carbothioamide |
| SMILES | CC1C=CN=C2/C(=N\NC(=S)N3CCN(c4cnccn4)CC3)CCOC21 |
| InChI | InChI=1S/C18H23N7OS/c1-13-2-4-21-16-14(3-11-26-17(13)16)22-23-18(27)25-9-7-24(8-10-25)15-12-19-5-6-20-15/h2,4-6,12-13,17H,3,7-11H2,1H3,(H,23,27)/b22-14- |
| InChIKey | PSLDGMBKUDPUMJ-HMAPJEAMSA-N |
| XLogP | 1.22 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|