About 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid
3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid (PubChem CID 12655699) has the molecular formula C6H6N2O3S
and a molecular weight of 186.19 g/mol. Its IUPAC name is 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid.
Molecular Properties
| Compound Name | 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid |
| PubChem CID | 12655699 |
| Molecular Formula | C6H6N2O3S |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid |
| SMILES | O=C(O)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C6H6N2O3S/c9-4(3-5(10)11)8-6-7-1-2-12-6/h1-2H,3H2,(H,10,11)(H,7,8,9) |
| InChIKey | BCETWEVGXCGUAQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid?
The IUPAC name of 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid (CID 12655699) is 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid.
What is the SMILES notation for 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid?
The canonical SMILES for 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid is O=C(O)CC(=O)Nc1nccs1.
What is the InChIKey of 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid?
The InChIKey is BCETWEVGXCGUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3S/c9-4(3-5(10)11)8-6-7-1-2-12-6/h1-2H,3H2,(H,10,11)(H,7,8,9).
What are the key properties of 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid?
3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid has a molecular weight of 186.19 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid is sourced from PubChem (CID 12655699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).