C6H6N2O3S — CID 12655699
3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid (PubChem CID 12655699) has the molecular formula C6H6N2O3S and a molecular weight of 186.19 g/mol. Its IUPAC name is 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid.
| Compound Name | 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 12655699 |
| Molecular Formula | C6H6N2O3S |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.01 |
| IUPAC Name | 3-oxo-3-(1,3-thiazol-2-ylamino)propanoic acid |
| SMILES | O=C(O)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C6H6N2O3S/c9-4(3-5(10)11)8-6-7-1-2-12-6/h1-2H,3H2,(H,10,11)(H,7,8,9) |
| InChIKey | BCETWEVGXCGUAQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|