C10H24NO3PS — CID 126559530
N,N-dimethyl-1-[(2-methylpropan-2-yl)oxy-propoxyphosphoryl]sulfanylmethanamine (PubChem CID 126559530) has the molecular formula C10H24NO3PS and a molecular weight of 269.35 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2-methylpropan-2-yl)oxy-propoxyphosphoryl]sulfanylmethanamine.
| Compound Name | N,N-dimethyl-1-[(2-methylpropan-2-yl)oxy-propoxyphosphoryl]sulfanylmethanamine |
|---|---|
| PubChem CID | 126559530 |
| Molecular Formula | C10H24NO3PS |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N,N-dimethyl-1-[(2-methylpropan-2-yl)oxy-propoxyphosphoryl]sulfanylmethanamine |
| SMILES | CCCOP(=O)(OC(C)(C)C)SCN(C)C |
| InChI | InChI=1S/C10H24NO3PS/c1-7-8-13-15(12,14-10(2,3)4)16-9-11(5)6/h7-9H2,1-6H3 |
| InChIKey | QTZCCYSMKCJOIH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|