C13H30NO3PS — CID 130474468
N,N-dimethyl-2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethanamine (PubChem CID 130474468) has the molecular formula C13H30NO3PS and a molecular weight of 311.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethanamine.
| Compound Name | N,N-dimethyl-2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethanamine |
|---|---|
| PubChem CID | 130474468 |
| Molecular Formula | C13H30NO3PS |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N,N-dimethyl-2-[(2-methylpropan-2-yl)oxy-pentan-2-yloxyphosphoryl]sulfanylethanamine |
| SMILES | CCCC(C)OP(=O)(OC(C)(C)C)SCCN(C)C |
| InChI | InChI=1S/C13H30NO3PS/c1-8-9-12(2)16-18(15,17-13(3,4)5)19-11-10-14(6)7/h12H,8-11H2,1-7H3 |
| InChIKey | ZOSYGIAYZUWWKH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|