C13H20Cl6NO3PS — CID 15938405
4-bis[(1,1,1-trichloro-2-methylpropan-2-yl)oxy]phosphorylsulfanyl-2-methylbutanenitrile (PubChem CID 15938405) has the molecular formula C13H20Cl6NO3PS and a molecular weight of 514.07 g/mol. Its IUPAC name is 4-bis[(1,1,1-trichloro-2-methylpropan-2-yl)oxy]phosphorylsulfanyl-2-methylbutanenitrile.
| Compound Name | 4-bis[(1,1,1-trichloro-2-methylpropan-2-yl)oxy]phosphorylsulfanyl-2-methylbutanenitrile |
|---|---|
| PubChem CID | 15938405 |
| Molecular Formula | C13H20Cl6NO3PS |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 510.90 |
| IUPAC Name | 4-bis[(1,1,1-trichloro-2-methylpropan-2-yl)oxy]phosphorylsulfanyl-2-methylbutanenitrile |
| SMILES | CC(C#N)CCSP(=O)(OC(C)(C)C(Cl)(Cl)Cl)OC(C)(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H20Cl6NO3PS/c1-9(8-20)6-7-25-24(21,22-10(2,3)12(14,15)16)23-11(4,5)13(17,18)19/h9H,6-7H2,1-5H3 |
| InChIKey | GTABIYLCWZGPAL-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|