C7H13FN2 — CID 126564830
(1E,3Z)-1-fluoro-2,3-dimethylpenta-1,3-diene-1,4-diamine (PubChem CID 126564830) has the molecular formula C7H13FN2 and a molecular weight of 144.19 g/mol. Its IUPAC name is (1E,3Z)-1-fluoro-2,3-dimethylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-fluoro-2,3-dimethylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 126564830 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | (1E,3Z)-1-fluoro-2,3-dimethylpenta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C(C)/C(C)=C(\N)F |
| InChI | InChI=1S/C7H13FN2/c1-4(6(3)9)5(2)7(8)10/h9-10H2,1-3H3/b6-4-,7-5- |
| InChIKey | UELSBEMYENAZLO-PEPZGXQESA-N |
| XLogP | 1.40 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|