C9H17N — CID 134858387
(2Z)-3,4,5-trimethylhexa-2,4-dien-2-amine (PubChem CID 134858387) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (2Z)-3,4,5-trimethylhexa-2,4-dien-2-amine.
| Compound Name | (2Z)-3,4,5-trimethylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 134858387 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2Z)-3,4,5-trimethylhexa-2,4-dien-2-amine |
| SMILES | CC(C)=C(C)/C(C)=C(/C)N |
| InChI | InChI=1S/C9H17N/c1-6(2)7(3)8(4)9(5)10/h10H2,1-5H3/b9-8- |
| InChIKey | FCMQTPFGQKXRKK-HJWRWDBZSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|