C10H14NY- — CID 59882702
2,3,4,5-tetramethylbenzene-6-id-1-amine;yttrium (PubChem CID 59882702) has the molecular formula C10H14NY- and a molecular weight of 237.13 g/mol. Its IUPAC name is 2,3,4,5-tetramethylbenzene-6-id-1-amine;yttrium.
| Compound Name | 2,3,4,5-tetramethylbenzene-6-id-1-amine;yttrium |
|---|---|
| PubChem CID | 59882702 |
| Molecular Formula | C10H14NY- |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2,3,4,5-tetramethylbenzene-6-id-1-amine;yttrium |
| SMILES | Cc1[c-]c(N)c(C)c(C)c1C.[Y] |
| InChI | InChI=1S/C10H14N.Y/c1-6-5-10(11)9(4)8(3)7(6)2;/h11H2,1-4H3;/q-1; |
| InChIKey | RDPZHVGNYOPRTO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|